maddills4n9aferboo maddills4n9aferboo

24-04-2017
History

contestada

Which cold war leader does the following text describe? the american president that committed the u.s. to a policy of containing communism

Respuesta :

martinlomeli8 martinlomeli8

24-04-2017

Dwight D. Eisenhower

Answer Link

Otras preguntas

Six people buy pumpkins for $5 each. How much is the total cost for all the pumpkins?

Josette found 16 coins in her purse. She had 2 more nickels than pennies and 7 fewer quarters than pennies. Josette modeled the scenario in a table and then wro

Pls help I need a good grade

According to the article, WHY did Herbert Wilson-Bey train three service dogs while he was in a maximum-security prison? Question options: to get out early so h

Write a story in which a ring, a key and a letter play an important part

The number of people estimated to vote in an election was 7,000. The actual number of people who voted was 5,600.By what percent did the estimate vary from actu

What are the 3 basic elements of a paragraph? Topic, Topic sentence, main idea topic, topic sentence, details Facts, support, details Examples, reasons, details

**EXTRA POINTS** Write a sensory response (five senses) to “Anticipation” for example anticipation feels like... looks like... smells like... sounds like... t

Tim goes on a car journey. for the first 15 minutes his average speed is 40 mph he then stops for 25 minutes he then completes the journey at an average speed o

Which of the following is the correct structure of 2-methyl-3-heptenea. CH3-CH2-C(CH3)=CH-CH2-CH2-CH3b. CH3-CH2CH=CH-CH2CH(CH3)-CH3c. CH3-CH2-CH=CH-CH-(CH3)-CH2