Give the IUPAC name of the given compound.

(CH3)-CH(NH2)-CH3

Question

24-07-2020
Chemistry

contestada

Give the IUPAC name of the given compound.

(CH3)-CH(NH2)-CH3

Respuesta :

Otras preguntas

Please help punitive 1. out in the open 2. of or related to punishment 3. of or relating to trees 4. not subject to injury

Hey, need some help rejoinder 1. ugly 2. reply 3. to follow 4. negligent

Which of these equations represent functions? Check all that apply. A. y = (x - 2)^2 + 5 B. x^2 - 4y^2 = 1 C. y = 3x - 3 D. y = 4x^5

how did manifest destiny affect both the settlement and the ultimate annexation of texas and oregon?

A triangle has a perimeter of 18 inches. If one side has length 8 inches, find the length of the shortest side if the other lengths are in the ratio of 2 units

Hey, need some help rejoinder 1. ugly 2. reply 3. to follow 4. negligent

Simplify. Assume that letters represent any real number.[tex] \sqrt[5]{x^5} [/tex]Rewrite without rational exponents, and simplify, if possible.[tex] 32^{3/5} [

Alfred is practicing typing. The first time he tested himself, he could type 23 words per minute. After practicing for a week, he could type 26 words per minute

1. Explain with reasons why burning of paper is a chemical change.

raduoprea160 raduoprea160 · Answer 1 · 2020-07-24T10:52:39+02:00

raduoprea160 raduoprea160

24-07-2020

this compound is called 2-propanamine 2 indicates the position of the amino group propan- indicates the radical (joy123333 do they make anyone a mod?)

Answer Link

Give the IUPAC name of the given compound.(CH3)-CH(NH2)-CH3

Respuesta :

Otras preguntas

Give the IUPAC name of the given compound.

(CH3)-CH(NH2)-CH3